CAS 1365272-67-8: Methyl 3′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate

Description:Methyl 3′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a fluoro group (-F) on the biphenyl framework contributes to its unique chemical properties, including potential reactivity and polarity. The carboxylate functional group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity in various chemical environments. This compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the cyano and fluoro substituents, making it potentially useful in materials science, pharmaceuticals, or as an intermediate in organic synthesis. Additionally, its molecular structure suggests that it may participate in various chemical reactions, including nucleophilic substitutions or coupling reactions, depending on the conditions. Overall, Methyl 3′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate is a versatile compound with applications in diverse fields of chemistry.

Formula:C₁₅H₁₀FNO₂

InChI:InChI=1S/C15H10FNO2/c1-19-15(18)13-6-5-12(8-14(13)16)11-4-2-3-10(7-11)9-17/h2-8H,1H3

InChI key:InChIKey=VAIMVURSIJCBBI-UHFFFAOYSA-N

SMILES:N#CC=1C=CC=C(C1)C=2C=CC(C(=O)OC)=C(F)C2

Synonyms:
[1,1′-Biphenyl]-4-carboxylic acid, 3′-cyano-3-fluoro-, methyl ester
Methyl 3′-cyano-3-fluoro[1,1′-biphenyl]-4-carboxylate

Found 3 products.

Product data	Purity	Price range	Estimated delivery
[1,1'-Biphenyl]-4-carboxylic acid, 3'-cyano-3-fluoro-, methyl ester REF: IN-DA001216CAS: 1365272-67-8	- - -	To inquire	Thu 27 Mar 25
Methyl 3'-cyano-3-fluoro-[1,1'-biphenyl]-4-carboxylate REF: 10-F236379CAS: 1365272-67-8	95.0%	- - -	Discontinued product
Methyl 4-(3-cyanophenyl)-2-fluorobenzoate REF: 3D-QEC27267CAS: 1365272-67-8	Min. 95%	- - -	Discontinued product