CAS 13725-02-5: 3-AMINO-1-BENZYL-PIPERIDINE-3-CARBOXYLIC ACID
Description:3-Amino-1-benzyl-piperidine-3-carboxylic acid, with the CAS number 13725-02-5, is an organic compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the piperidine ring, along with a benzyl group (-C6H5-CH2-) that enhances its structural complexity. The presence of these functional groups contributes to its potential as a building block in pharmaceutical synthesis and medicinal chemistry. The compound is likely to exhibit basic properties due to the amino group and acidic properties from the carboxylic acid, allowing it to participate in various chemical reactions, such as amide formation or esterification. Additionally, its structural features may influence its solubility, reactivity, and biological activity, making it of interest in drug development and research. Overall, 3-amino-1-benzyl-piperidine-3-carboxylic acid is a versatile compound with potential applications in various chemical and biological contexts.
Formula:C13H18N2O2
InChI:InChI=1/C13H18N2O2/c14-13(12(16)17)7-4-8-15(10-13)9-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10,14H2,(H,16,17)
- Synonyms:
- 3-Amino-1-Benzyl-3-Piperidinecarboxylic Acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Piperidinecarboxylic acid, 3-amino-1-(phenylmethyl)- REF: IN-DA001301CAS: 13725-02-5 | 97% | 197.00 €~587.00 € | Thu 27 Mar 25 |
![]() | 3-Amino-1-benzyl-piperidine-3-carboxylic acid REF: 3D-NAA72502CAS: 13725-02-5 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 3-Amino-1-benzylpiperidine-3-carboxylic acid REF: 10-F718742CAS: 13725-02-5 | 98% | - - - | Discontinued product |

3-Piperidinecarboxylic acid, 3-amino-1-(phenylmethyl)-
Ref: IN-DA001301
1g | 587.00 € | ||
250mg | 197.00 € | ||
500mg | 295.00 € |

3-Amino-1-benzyl-piperidine-3-carboxylic acid
Ref: 3D-NAA72502
1g | 873.00 € | ||
100mg | 406.00 € |

3-Amino-1-benzylpiperidine-3-carboxylic acid
Ref: 10-F718742
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
2.5g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |