CAS 137352-74-0: 3-methyl-4-pyrrol-1-yl-phenol
Description:3-Methyl-4-pyrrol-1-yl-phenol, identified by its CAS number 137352-74-0, is an organic compound characterized by a phenolic structure with a pyrrole ring and a methyl group. This compound typically exhibits properties associated with both phenols and nitrogen-containing heterocycles, which may influence its reactivity and solubility. It is likely to be a solid at room temperature, with potential applications in various fields such as pharmaceuticals, agrochemicals, or materials science due to its unique structural features. The presence of the hydroxyl group (-OH) in the phenol moiety suggests that it may engage in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the methyl group can influence the compound's electronic properties and steric hindrance, potentially impacting its biological activity. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this substance would need to be assessed through further research and data.
Formula:C11H11NO
InChI:InChI=1/C11H11NO/c1-9-8-10(13)4-5-11(9)12-6-2-3-7-12/h2-8,13H,1H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Phenol, 3-methyl-4-(1H-pyrrol-1-yl)- REF: IN-DA001365CAS: 137352-74-0 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 3-methyl-4-(1H-pyrrol-1-yl)phenol REF: 10-F310988CAS: 137352-74-0 | 95.0% | To inquire | Tue 08 Apr 25 |
![]() | 3-Methyl-4-(1H-pyrrol-1-yl)phenol REF: 3D-MFA35274CAS: 137352-74-0 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA001365
Undefined size | To inquire |

Ref: 10-F310988
1g | To inquire |

3-Methyl-4-(1H-pyrrol-1-yl)phenol
Ref: 3D-MFA35274
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |