CAS 13746-54-8: 2-Methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol

Description: 2-Methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol, with the CAS number 13746-54-8, is an organic compound characterized by its complex bicyclic structure and the presence of both methoxy and phenolic functional groups. This compound features a methoxy group (-OCH3) attached to a phenolic ring, which contributes to its potential as an antioxidant and a stabilizer in various applications. The bicyclic portion of the molecule, specifically the 5,5,6-trimethylbicyclo[2.2.1]heptane moiety, imparts unique steric and electronic properties, influencing its reactivity and interactions with other substances. The presence of multiple methyl groups enhances its hydrophobic character, which may affect its solubility in different solvents. Additionally, the compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and materials science. Overall, its structural features suggest potential utility in various chemical and industrial applications, although specific properties such as melting point, boiling point, and solubility would require empirical determination.

Formula: C₁₇H₂₄O₂

InChI: InChI=1S/C17H24O2/c1-10-13-8-12(17(10,2)3)9-14(13)11-5-6-15(18)16(7-11)19-4/h5-7,10,12-14,18H,8-9H2,1-4H3

InChI key: InChIKey=NUEKYQUPPRJHFP-UHFFFAOYSA-N

SMILES: OC1=CC=C(C=C1OC)C2CC3CC2C(C)C3(C)C

Synonyms:

• 2-Methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)phenol
• Phenol, 2-methoxy-4-(5,5,6-trimethyl-2-norbornyl)-
• 2-Methoxy-4-(2,2,3-trimethyl-5-bicyclo[2.2.1]heptanyl)phenol
• Phenol, 2-methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]hept-2-yl)-
• 4-(5-Isocamphyl)guaiacol

2-Methoxy-4-(5,5,6-trimethylbicyclo[2.2.1]Heptan-2-yl)phenol

CAS: 13746-54-8

• Purity: 98%
• Molecular weight: 260.37701416015625