CAS 1374651-78-1: 6-Bromo-5-(trifluoromethoxy)-1H-indazole
Description:6-Bromo-5-(trifluoromethoxy)-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 6-position and a trifluoromethoxy group at the 5-position significantly influences its chemical properties and reactivity. This compound is likely to exhibit unique electronic characteristics due to the electron-withdrawing nature of the trifluoromethoxy group, which can enhance its potential as a pharmacophore in medicinal chemistry. The bromine substituent may also provide opportunities for further functionalization through nucleophilic substitution reactions. Additionally, the presence of fluorine atoms can improve the compound's metabolic stability and lipophilicity, making it a candidate for drug development. Its specific applications may vary, but compounds with similar structures are often investigated for their biological activities, including anti-inflammatory and anticancer properties. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity and reactivity.
Formula:C8H4BrF3N2O
InChI:InChI=1S/C8H4BrF3N2O/c9-5-2-6-4(3-13-14-6)1-7(5)15-8(10,11)12/h1-3H,(H,13,14)
InChI key:InChIKey=XWGFFCNWBMBDHZ-UHFFFAOYSA-N
SMILES:FC(F)(F)OC1=CC=2C=NNC2C=C1Br
- Synonyms:
- 1H-Indazole, 6-bromo-5-(trifluoromethoxy)-
- 6-Bromo-5-(trifluoromethoxy)-1H-indazole
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 6-broMo-5-(trifluoroMethoxy)-1H-indazole REF: IN-DA00A5LWCAS: 1374651-78-1 | 98% | To inquire | Thu 27 Mar 25 |
![]() | 6-Bromo-5-(trifluoromethoxy)-1H-indazole REF: 54-PC400173CAS: 1374651-78-1 | - - - | 172.00 €~552.00 € | Fri 28 Mar 25 |
![]() | 6-Bromo-5-(trifluoromethoxy)-1h-indazole REF: 10-F719230CAS: 1374651-78-1 | 98+% | 146.00 €~562.00 € | Tue 01 Apr 25 |
![]() | 6-BROMO-5-(TRIFLUOROMETHOXY)-1H-INDAZOLE REF: 10-F471937CAS: 1374651-78-1 | 95.0% | - - - | Discontinued product |
![]() | 6-Bromo-5-(trifluoromethoxy)-1H-indazole REF: 3D-ZEC65178CAS: 1374651-78-1 | Min. 95% | - - - | Discontinued product |

6-broMo-5-(trifluoroMethoxy)-1H-indazole
Ref: IN-DA00A5LW
1g | To inquire | ||
100mg | 180.00 € | ||
250mg | 314.00 € | ||
500mg | 518.00 € |

6-Bromo-5-(trifluoromethoxy)-1H-indazole
Ref: 54-PC400173
1g | 552.00 € | ||
250mg | 172.00 € |

6-Bromo-5-(trifluoromethoxy)-1h-indazole
Ref: 10-F719230
1g | 562.00 € | ||
100mg | 146.00 € | ||
250mg | 175.00 € | ||
500mg | 307.00 € |

6-BROMO-5-(TRIFLUOROMETHOXY)-1H-INDAZOLE
Ref: 10-F471937
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

6-Bromo-5-(trifluoromethoxy)-1H-indazole
Ref: 3D-ZEC65178
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |