CAS 1375471-82-1: 5-(Chlorosulfonyl)-3-fluoro-2-methoxybenzoic acid

Description:5-(Chlorosulfonyl)-3-fluoro-2-methoxybenzoic acid is an organic compound characterized by the presence of a benzoic acid structure with specific substituents that impart unique chemical properties. The compound features a chlorosulfonyl group, which enhances its reactivity, particularly in nucleophilic substitution reactions. The fluorine atom introduces electronegativity, influencing the compound's polarity and potential interactions with other molecules. The methoxy group contributes to the compound's solubility in organic solvents and may affect its overall stability and reactivity. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, allowing it to participate in acid-base reactions. Its structural characteristics suggest potential applications in pharmaceuticals or agrochemicals, where such functional groups can play critical roles in biological activity or chemical reactivity. Overall, the combination of these functional groups makes 5-(Chlorosulfonyl)-3-fluoro-2-methoxybenzoic acid a versatile compound in synthetic organic chemistry.

Formula:C₈H₆ClFO₅S

InChI:InChI=1S/C8H6ClFO5S/c1-15-7-5(8(11)12)2-4(3-6(7)10)16(9,13)14/h2-3H,1H3,(H,11,12)

InChI key:InChIKey=UYRCVLRZHKVNNE-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC(=CC(F)=C1OC)S(=O)(=O)Cl

Synonyms:
5-(Chlorosulfonyl)-3-fluoro-2-methoxybenzoic acid
Benzoic acid, 5-(chlorosulfonyl)-3-fluoro-2-methoxy-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-(Chlorosulfonyl)-3-fluoro-2-methoxybenzoic acid REF: 10-F739537CAS: 1375471-82-1	95%	- - -	Discontinued product
	5-(Chlorosulfonyl)-3-fluoro-2-methoxybenzoic acid REF: 3D-AFC47182CAS: 1375471-82-1	Min. 95%	- - -	Discontinued product