CAS 1375473-07-6: 6-(Trifluoromethyl)-2-morpholinecarboxylic acid

Description:6-(Trifluoromethyl)-2-morpholinecarboxylic acid is a chemical compound characterized by the presence of a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. The trifluoromethyl group attached to the carbon chain significantly influences the compound's chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The trifluoromethyl group can also impart unique reactivity and stability characteristics, making it of interest in various fields, including medicinal chemistry and agrochemicals. Its molecular structure suggests potential applications in drug development, particularly in designing compounds with specific pharmacological properties. As with many fluorinated compounds, it may exhibit distinct behavior in biological systems, warranting further investigation into its toxicity and environmental impact.

Formula:C₆H₈F₃NO₃

InChI:InChI=1S/C6H8F3NO3/c7-6(8,9)4-2-10-1-3(13-4)5(11)12/h3-4,10H,1-2H2,(H,11,12)

InChI key:InChIKey=CUAWHSMWBLIBFU-UHFFFAOYSA-N

SMILES:O=C(O)C1OC(CNC1)C(F)(F)F

Synonyms:
6-(Trifluoromethyl)-2-morpholinecarboxylic acid
2-Morpholinecarboxylic acid, 6-(trifluoromethyl)-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	6-(Trifluoromethyl)morpholine-2-carboxylic acid REF: 10-F704900CAS: 1375473-07-6	97%	- - -	Discontinued product
	6-(Trifluoromethyl)morpholine-2-carboxylic acid REF: 3D-AFC47307CAS: 1375473-07-6	Min. 95%	- - -	Discontinued product