CAS 137686-93-2: 2H-1-Benzopyran-2-one, 4-methyl-7-[[3,4,6-tri-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]-β-D-glucopyranosyl]oxy]-
Description:The chemical substance known as "2H-1-Benzopyran-2-one, 4-methyl-7-[[3,4,6-tri-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]-β-D-glucopyranosyl]oxy]-" with CAS number 137686-93-2 is a complex organic compound characterized by its benzopyran structure, which is a fused ring system consisting of a benzene ring and a pyran ring. This compound features multiple functional groups, including a methyl group and a glucopyranosyl moiety that is heavily acetylated, indicating the presence of several acetyl groups attached to the sugar unit. The trifluoroacetyl group suggests enhanced lipophilicity and potential biological activity. The presence of these functional groups may contribute to its solubility in organic solvents and its reactivity in various chemical environments. Such compounds are often studied for their potential pharmacological properties, including anti-inflammatory and anticancer activities, due to the bioactive nature of the benzopyran and sugar derivatives. Overall, this compound exemplifies the complexity and diversity of organic molecules in medicinal chemistry.
Formula:C24H24F3NO11
InChI:InChI=1S/C24H24F3NO11/c1-10-7-18(32)38-16-8-14(5-6-15(10)16)37-22-19(28-23(33)24(25,26)27)21(36-13(4)31)20(35-12(3)30)17(39-22)9-34-11(2)29/h5-8,17,19-22H,9H2,1-4H3,(H,28,33)/t17-,19-,20-,21-,22-/m1/s1
InChI key:InChIKey=MGLRSUPYLXVODY-MSEOUXRUSA-N
SMILES:O=C1OC=2C=C(OC3OC(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C3NC(=O)C(F)(F)F)C=CC2C(=C1)C
- Synonyms:
- 2H-1-Benzopyran-2-one, 4-methyl-7-[[3,4,6-tri-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]-β-D-glucopyranosyl]oxy]-

2H-1-Benzopyran-2-one, 4-methyl-7-[[3,4,6-tri-O-acetyl-2-deoxy-2-[(trifluoroacetyl)amino]-β-D-glucopyranosyl]oxy]- (9CI)
Ref: IN-DA0013QS
Undefined size | To inquire |

4-Methylumbelliferyl 3,4,6-tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranoside
Ref: 7W-GC1491
Undefined size | To inquire |

4-Methylumbelliferyl 2-Trifluoroacetyl-3,4,6-O-triacetyl-2-deoxy-Beta-D-glucopyranoside
Controlled ProductRef: TR-M337630
25mg | 102.00 € |

4-Methylumbelliferyl 3,4,6-tri-O-acetyl-2-deoxy-2-trifluoroacetamido-b-D-glucopyranoside
Ref: 3D-EM03204
50mg | 344.00 € | ||
100mg | 623.00 € |