CAS 1379811-98-9: 3-(3-Bromophenyl)-3-oxetanol
Description:3-(3-Bromophenyl)-3-oxetanol is a chemical compound characterized by its oxetane ring, which is a four-membered cyclic ether. The presence of a bromophenyl group indicates that there is a bromine atom attached to a phenyl ring at the 3-position of the oxetane. This structure contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The compound is likely to exhibit properties typical of both oxetanes and brominated aromatic compounds, such as moderate polarity and the ability to participate in nucleophilic substitution reactions due to the presence of the bromine atom. Additionally, the oxetane ring can influence the compound's strain and stability, affecting its reactivity. As with many organic compounds, its solubility, melting point, and boiling point would depend on the specific molecular interactions and the presence of functional groups. Safety data and handling precautions should be considered, as brominated compounds can pose environmental and health risks.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c10-8-3-1-2-7(4-8)9(11)5-12-6-9/h1-4,11H,5-6H2
InChI key:InChIKey=YPFCZNOBTKPTHB-UHFFFAOYSA-N
SMILES:BrC1=CC=CC(=C1)C2(O)COC2

3-(3-Bromophenyl)oxetan-3-ol
Ref: IN-DA00HV73
1g | 608.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 165.00 € | ||
250mg | 233.00 € | ||
500mg | 518.00 € |

Ref: 10-F475001
1g | 828.00 € | ||
5g | 3,296.00 € | ||
100mg | 179.00 € | ||
250mg | 322.00 € | ||
500mg | 561.00 € |

3-(3-Bromophenyl)oxetan-3-ol
Ref: 3D-EFC81198
50mg | 560.00 € | ||
500mg | 1,536.00 € |