
CAS 1380327-68-3: (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]methylamino]-1-naphthalenepropanoic acid
Description:The chemical substance known as (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]methylamino]-1-naphthalenepropanoic acid, with the CAS number 1380327-68-3, is a synthetic compound primarily used in the field of medicinal chemistry and peptide synthesis. It features a complex structure that includes a naphthalene moiety, which contributes to its hydrophobic characteristics, and a fluorenylmethoxycarbonyl (Fmoc) protecting group, commonly utilized in solid-phase peptide synthesis to protect amino groups. The presence of the methylamino group enhances its reactivity and potential interactions in biological systems. This compound is typically characterized by its solubility in organic solvents and limited solubility in water, which is common for many organic compounds with large aromatic systems. Its stereochemistry, indicated by the (αS) designation, suggests specific spatial arrangements that may influence its biological activity and interactions with other molecules. Overall, this compound is of interest for its potential applications in drug development and as a building block in the synthesis of more complex molecules.
Formula:C29H25NO4
InChI:InChI=1S/C29H25NO4/c1-30(27(28(31)32)17-20-11-8-10-19-9-2-3-12-21(19)20)29(33)34-18-26-24-15-6-4-13-22(24)23-14-5-7-16-25(23)26/h2-16,26-27H,17-18H2,1H3,(H,31,32)/t27-/m0/s1
InChI key:InChIKey=MHVRUCBIMARVSP-MHZLTWQESA-N
SMILES:O=C(O)C(N(C(=O)OCC1C=2C=CC=CC2C=3C=CC=CC31)C)CC4=CC=CC=5C=CC=CC54
- Synonyms:
- 1-Naphthalenepropanoic acid, α-[[(9H-fluoren-9-ylmethoxy)carbonyl]methylamino]-, (αS)-
- (αS)-α-[[(9H-Fluoren-9-ylmethoxy)carbonyl]methylamino]-1-naphthalenepropanoic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | N-Fmoc-N-methyl-3-(1-naphthyl)-L-alanine REF: IN-DA01JMJVCAS: 1380327-68-3 | 97% | 262.00 €~563.00 € | Thu 27 Mar 25 |
![]() | N-Fmoc-N-methyl-3-(1-naphthyl)-L-alanine REF: 10-F765084CAS: 1380327-68-3 | 98% | - - - | Discontinued product |
![]() | 2-[9H-Fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-1-ylpropanoic acid REF: 3D-FFC32768CAS: 1380327-68-3 | Min. 95% | - - - | Discontinued product |

N-Fmoc-N-methyl-3-(1-naphthyl)-L-alanine
Ref: IN-DA01JMJV
1g | 563.00 € | ||
250mg | 262.00 € | ||
500mg | 531.00 € |

N-Fmoc-N-methyl-3-(1-naphthyl)-L-alanine
Ref: 10-F765084
250mg | Discontinued | Request information |

2-[9H-Fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-naphthalen-1-ylpropanoic acid
Ref: 3D-FFC32768
5g | Discontinued | Request information |