CAS 13808-65-6: 4-BROMO-3-PHENYL-1H-PYRAZOLE
Description:4-Bromo-3-phenyl-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of a bromine atom at the 4-position and a phenyl group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic phenyl group. It is often utilized in medicinal chemistry and research due to its potential biological activities, including anti-inflammatory and anticancer properties. The bromine substituent can enhance the compound's reactivity, making it a useful intermediate in various synthetic pathways. Additionally, 4-bromo-3-phenyl-1H-pyrazole can participate in electrophilic aromatic substitution reactions and other transformations, which are valuable in the development of new pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H7BrN2
InChI:InChI=1S/C9H7BrN2/c10-8-6-11-12-9(8)7-4-2-1-3-5-7/h1-6H,(H,11,12)
InChI key:InChIKey=ZJFUSLGMGSYTRY-UHFFFAOYSA-N
SMILES:BrC1=CNN=C1C=2C=CC=CC2
- Synonyms:
- 4-Bromo-3-phenyl-1H-pyrazole
- 1H-Pyrazole, 4-bromo-3-phenyl-
- 4-Bromo-3-phenylpyrazole
- Pyrazole, 4-bromo-3-phenyl-

4-Bromo-3-phenylpyrazole
Ref: 3B-B5181
1g | 143.00 € | ||
200mg | 51.00 € |

1H-Pyrazole, 4-bromo-3-phenyl-
Ref: IN-DA0017YU
1g | 42.00 € | ||
5g | 90.00 € | ||
10g | 142.00 € | ||
25g | 222.00 € | ||
100mg | 26.00 € | ||
250mg | 26.00 € |

Ref: 54-OR350030
1g | 32.00 € | ||
5g | 95.00 € | ||
25g | 419.00 € | ||
100g | 1,493.00 € |

4-Bromo-3-phenyl-1H-pyrazole
Ref: 10-F363432
1g | 20.00 € | ||
5g | 87.00 € | ||
25g | 356.00 € |

4-Bromo-3-phenyl-1(2)H-pyrazole
Ref: 3D-FB175249
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |