CAS 1383152-72-4: 3-(Cyclohexyloxy)benzenepropanol

Description:3-(Cyclohexyloxy)benzenepropanol is an organic compound characterized by its structural features, which include a benzene ring substituted with a cyclohexyloxy group and a propanol moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential solubility in various organic solvents. The presence of the cyclohexyl group may impart hydrophobic characteristics, while the hydroxyl group in the propanol part can enhance hydrogen bonding capabilities, influencing its reactivity and interaction with other molecules. As a result, this compound may exhibit moderate polarity, making it suitable for applications in pharmaceuticals or as an intermediate in organic synthesis. Its specific physical and chemical properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and the overall structure. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage in laboratory or industrial settings.

Formula:C₁₅H₂₂O₂

InChI:InChI=1S/C15H22O2/c16-11-5-7-13-6-4-10-15(12-13)17-14-8-2-1-3-9-14/h4,6,10,12,14,16H,1-3,5,7-9,11H2

InChI key:InChIKey=FRABBQXLSUWFFM-UHFFFAOYSA-N

SMILES:OCCCC=1C=CC=C(OC2CCCCC2)C1