CAS 1384427-49-9: 2,4-Diethyl 2,4-piperidinedicarboxylate

Description:2,4-Diethyl 2,4-piperidinedicarboxylate is a chemical compound characterized by its piperidine structure, which features two ethyl groups and two carboxylate functional groups attached to the piperidine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is soluble in organic solvents, reflecting its non-polar characteristics due to the ethyl substituents. The presence of the carboxylate groups suggests potential for hydrogen bonding and reactivity, making it useful in various chemical syntheses and applications. As a diester, it may participate in reactions typical of esters, such as hydrolysis or transesterification. The compound's unique structure may also impart specific biological activities, making it of interest in pharmaceutical research. However, detailed safety and handling information should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula:C₁₁H₁₉NO₄

InChI:InChI=1S/C11H19NO4/c1-3-15-10(13)8-5-6-12-9(7-8)11(14)16-4-2/h8-9,12H,3-7H2,1-2H3

InChI key:InChIKey=JLXRBGYOTRAJHY-UHFFFAOYSA-N

SMILES:O=C(OCC)C1NCCC(C(=O)OCC)C1

Synonyms:
2,4-Piperidinedicarboxylic acid, 2,4-diethyl ester
2,4-Diethyl 2,4-piperidinedicarboxylate

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Diethyl piperidine-2,4-dicarboxylate REF: 10-F705064CAS: 1384427-49-9	95%	- - -	Discontinued product
	2,4-Diethyl piperidine-2,4-dicarboxylate REF: 3D-JFC42749CAS: 1384427-49-9	Min. 95%	- - -	Discontinued product