CAS 1391052-61-1: 2-[[2-(3-Carboxypropyl)-1-methyl-1H-benzimidazol-5-yl](2-hydroxyethyl)amino]ethyl 5-[bis(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoate
Description:The chemical substance with the name "2-[[2-(3-Carboxypropyl)-1-methyl-1H-benzimidazol-5-yl](2-hydroxyethyl)amino]ethyl 5-[bis(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoate" and CAS number 1391052-61-1 is a complex organic compound characterized by its multi-functional structure, which includes benzimidazole moieties, carboxypropyl groups, and hydroxyethyl amino functionalities. This compound is likely to exhibit properties typical of benzimidazole derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the benzimidazole core, which is known for its pharmacological significance. The presence of carboxylic acid and amino groups suggests that it may engage in hydrogen bonding and ionic interactions, enhancing its solubility in polar solvents. Additionally, the compound's structure indicates it may have applications in medicinal chemistry or as a biochemical probe. Its stability, reactivity, and specific interactions would depend on the surrounding pH and environmental conditions, making it a subject of interest for further research in drug development and biochemical applications.
Formula:C32H44N6O7
InChI:InChI=1S/C32H44N6O7/c1-35-28-12-10-24(22-26(28)33-29(35)5-3-7-31(42)43)38(15-19-41)16-20-45-32(44)8-4-6-30-34-25-21-23(9-11-27(25)36(30)2)37(13-17-39)14-18-40/h9-12,21-22,39-41H,3-8,13-20H2,1-2H3,(H,42,43)
InChI key:InChIKey=VHWAIJZTTMEEBD-UHFFFAOYSA-N
SMILES:O=C(O)CCCC1=NC=2C=C(C=CC2N1C)N(CCO)CCOC(=O)CCCC3=NC=4C=C(C=CC4N3C)N(CCO)CCO
- Synonyms:
- 1H-Benzimidazole-2-butanoic acid, 5-[bis(2-hydroxyethyl)amino]-1-methyl-, 2-[[2-(3-carboxypropyl)-1-methyl-1H-benzimidazol-5-yl](2-hydroxyethyl)amino]ethyl ester
- 2-[[2-(3-Carboxypropyl)-1-methyl-1H-benzimidazol-5-yl](2-hydroxyethyl)amino]ethyl 5-[bis(2-hydroxyethyl)amino]-1-methyl-1H-benzimidazole-2-butanoate

Bendamustine Deschloro Dimer Impurity
Ref: 4Z-B-4312
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

Bendamustine Deschloro Dimer Impurity
Controlled ProductRef: TR-B132515
25mg | 12,015.00 € |

Bendamustine deschloro dimer impurity
Ref: 3D-RFC05261
5mg | 1,063.00 € | ||
10mg | 1,479.00 € | ||
25mg | 2,773.00 € | ||
50mg | 4,436.00 € |