CAS 1392015-56-3: Methyl 6-chloro-2-benzothiazolecarboxylate

Description: Methyl 6-chloro-2-benzothiazolecarboxylate is a chemical compound characterized by its benzothiazole core, which features a chlorine substituent at the 6-position and a methyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of the chlorine atom and the carboxylate group. The benzothiazole moiety contributes to its biological activity, making it of interest in pharmaceutical and agrochemical research. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Additionally, due to the presence of the chlorine atom, it may exhibit unique chemical reactivity, including nucleophilic substitution reactions. Overall, Methyl 6-chloro-2-benzothiazolecarboxylate is a versatile compound with potential applications in various fields, including medicinal chemistry and material science.

Formula: C₉H₆ClNO₂S

InChI: InChI=1S/C9H6ClNO2S/c1-13-9(12)8-11-6-3-2-5(10)4-7(6)14-8/h2-4H,1H3

InChI key: InChIKey=QBFZHNDPUSOYNU-UHFFFAOYSA-N

SMILES: O=C(OC)C1=NC=2C=CC(Cl)=CC2S1

Synonyms:

• Methyl 6-chloro-2-benzothiazolecarboxylate
• 2-Benzothiazolecarboxylic acid, 6-chloro-, methyl ester

2-Benzothiazolecarboxylic acid, 6-chloro-, methyl ester

CAS: 1392015-56-3

• Formula: C₉H₆ClNO₂S
• Molecular weight: 227.6674

Methyl 6-chlorobenzo[D]thiazole-2-carboxylate

CAS: 1392015-56-3

Versatile small molecule scaffold

• Formula: C₉H₆ClNO₂S
• Purity: Min. 95%
• Molecular weight: 227.67 g/mol