CAS 139272-67-6: 2-Ethoxy-2-oxoethyl 2-[(2,6-dichlorophenyl)amino]benzeneacetate
Description:2-Ethoxy-2-oxoethyl 2-[(2,6-dichlorophenyl)amino]benzeneacetate, with the CAS number 139272-67-6, is a chemical compound that belongs to the class of esters and amides. This substance features a complex molecular structure characterized by the presence of an ethoxy group, a ketone functional group, and an aromatic amine moiety. The dichlorophenyl group indicates the presence of chlorine substituents on the aromatic ring, which can influence the compound's reactivity and biological activity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of multiple functional groups suggests potential for diverse interactions in biological systems, including enzyme inhibition or receptor binding. Additionally, the compound's solubility, stability, and reactivity can be influenced by its molecular structure, which is essential for applications in drug development or synthesis. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated aromatic compounds.
Formula:C18H17Cl2NO4
InChI:InChI=1S/C18H17Cl2NO4/c1-2-24-17(23)11-25-16(22)10-12-6-3-4-9-15(12)21-18-13(19)7-5-8-14(18)20/h3-9,21H,2,10-11H2,1H3
InChI key:InChIKey=JDOYJDOPEHMRPB-UHFFFAOYSA-N
SMILES:O=C(OCC)COC(=O)CC=1C=CC=CC1NC=2C(Cl)=CC=CC2Cl
- Synonyms:
- Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-, 2-ethoxy-2-oxoethyl ester
- 2-Ethoxy-2-oxoethyl 2-[(2,6-dichlorophenyl)amino]benzeneacetate
- 2-Ethoxy-2-oxoethyl 2-(2-(2,6-dichlorophenylamino)-phenyl)acetate
- 2-Ethoxy-2-oxoethyl 2-(2-((2,6-dichlorophenyl)amino)phenyl)acetate
![2-Ethoxy-2-oxoethyl 2-[(2,6-dichlorophenyl)amino]benzeneacetate](https://static.cymitquimica.com/cas-image/299703-2-ethoxy-2-oxoethyl-2-26-dichlorophenyl-amino-benzeneacetate.png)
![Benzeneacetic acid, 2-[(2,6-dichlorophenyl)amino]-, 2-ethoxy-2-oxoethyl ester](https://static.cymitquimica.com/products/IN/thumb/DA001AMX.jpg)
![Ethyl [[[2-[(2,6-Dichlorophenyl)amino]phenyl]acetyl]oxy]acetate (Ethyl Ester of Aceclofenac)](https://static.cymitquimica.com/products/86/thumb/MM0181.02.jpg)
