CAS 1393728-46-5: 4-Bromo-1,2,5-trimethyl-1H-pyrrole-3-carbonitrile

Description: 4-Bromo-1,2,5-trimethyl-1H-pyrrole-3-carbonitrile is a heterocyclic organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. The presence of a bromine atom at the 4-position and a cyano group at the 3-position contributes to its reactivity and potential applications in organic synthesis. The three methyl groups at the 1, 2, and 5 positions enhance the compound's lipophilicity and influence its electronic properties. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential uses in the development of pharmaceuticals or agrochemicals. Additionally, the presence of the cyano group can facilitate various chemical reactions, such as nucleophilic additions or cycloadditions. As with many brominated compounds, it may also exhibit unique properties related to its halogen content, such as increased stability or specific interactions with biological targets. Safety and handling precautions should be observed due to the potential toxicity associated with brominated and nitrile compounds.

Formula: C₈H₉BrN₂

InChI: InChI=1S/C8H9BrN2/c1-5-7(4-10)8(9)6(2)11(5)3/h1-3H3

InChI key: InChIKey=ZGTFAXKHYWAEED-UHFFFAOYSA-N

SMILES: N#CC=1C(Br)=C(N(C1C)C)C

Synonyms:

• 4-Bromo-1,2,5-trimethyl-1H-pyrrole-3-carbonitrile
• 1H-Pyrrole-3-carbonitrile, 4-bromo-1,2,5-trimethyl-

4-bromo-1,2,5-trimethyl-1H-pyrrole-3-carbonitrile

CAS: 1393728-46-5

• Purity: 95.0%
• Molecular weight: 213.0780029296875

4-Bromo-1,2,5-trimethyl-1H-pyrrole-3-carbonitrile

CAS: 1393728-46-5

Versatile small molecule scaffold

• Formula: C₈H₉BrN₂
• Purity: Min. 95%
• Molecular weight: 213.07 g/mol