
CAS 1393732-46-1: 1,1-Dimethylethyl 3-hydroxy-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
Description:1,1-Dimethylethyl 3-hydroxy-3-(hydroxymethyl)-1-pyrrolidinecarboxylate, identified by its CAS number 1393732-46-1, is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound includes functional groups such as hydroxyl (-OH) and ester groups, contributing to its potential reactivity and solubility properties. The presence of the dimethyl group indicates steric hindrance, which may influence its interactions with other molecules. Typically, compounds of this nature can exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The hydroxymethyl group suggests potential for further derivatization, which could enhance its chemical properties or biological efficacy. Additionally, the compound's stability, polarity, and solubility in various solvents can be influenced by its structural features, making it a candidate for various applications in organic synthesis and drug development. As with any chemical substance, safety data and handling precautions should be observed due to potential hazards associated with its use.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-9(2,3)15-8(13)11-5-4-10(14,6-11)7-12/h12,14H,4-7H2,1-3H3
InChI key:InChIKey=RMEKXQFQLXPULQ-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1CCC(O)(CO)C1
- Synonyms:
- 1,1-Dimethylethyl 3-hydroxy-3-(hydroxymethyl)-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 3-hydroxy-3-(hydroxymethyl)-, 1,1-dimethylethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | tert-Butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate REF: 10-F610321CAS: 1393732-46-1 | 97% | - - - | Discontinued product |
![]() | tert-Butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate REF: 3D-TFC73246CAS: 1393732-46-1 | Min. 95% | - - - | Discontinued product |

tert-Butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Ref: 10-F610321
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

tert-Butyl 3-hydroxy-3-(hydroxymethyl)pyrrolidine-1-carboxylate
Ref: 3D-TFC73246
10mg | Discontinued | Request information | |
100mg | Discontinued | Request information |