CAS 1394040-43-7: 3-(Aminomethyl)tetrahydro-3-furanethanol

Description: 3-(Aminomethyl)tetrahydro-3-furanethanol is an organic compound characterized by its unique structure, which includes a tetrahydrofuran ring and an amino group. This compound features a hydroxymethyl group attached to the furan ring, contributing to its potential as a versatile building block in organic synthesis. The presence of the amino group suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, the hydroxyl group can engage in hydrogen bonding, influencing its solubility and reactivity. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases, as they are not universally defined. Overall, 3-(Aminomethyl)tetrahydro-3-furanethanol represents a class of compounds with potential utility in various chemical applications.

Formula: C₇H₁₅NO₂

InChI: InChI=1S/C7H15NO2/c8-5-7(1-3-9)2-4-10-6-7/h9H,1-6,8H2

InChI key: InChIKey=QZFVKXCEBXGBIT-UHFFFAOYSA-N

SMILES: OCCC1(COCC1)CN

Synonyms:

• 3-(Aminomethyl)tetrahydro-3-furanethanol
• 3-Furanethanol, 3-(aminomethyl)tetrahydro-

2-[3-(Aminomethyl)oxolan-3-yl]ethan-1-ol

CAS: 1394040-43-7

Versatile small molecule scaffold

• Formula: C₇H₁₅NO₂
• Purity: Min. 95%
• Molecular weight: 145.2 g/mol

3-(Aminomethyl)tetrahydro-3-furanethanol

CAS: 1394040-43-7

• Purity: 98%
• Molecular weight: 145.20199584960938