CAS 139423-25-9: N-[5-[(2-Amino-1,2-dithioxoethyl)amino]-4-methylpentyl]octanamide

Description:N-[5-[(2-Amino-1,2-dithioxoethyl)amino]-4-methylpentyl]octanamide, with the CAS number 139423-25-9, is a synthetic organic compound characterized by its complex structure, which includes an octanamide backbone and a side chain featuring a 2-amino-1,2-dithioxoethyl group. This compound is likely to exhibit properties typical of amides, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the presence of the amide functional group. The presence of sulfur in the dithioxoethyl moiety may impart unique reactivity and stability characteristics, potentially influencing its biological activity and interactions with other molecules. Additionally, the branched alkyl chain contributes to its hydrophobic nature, which may affect its partitioning behavior in biological systems. Overall, the specific characteristics, including melting point, boiling point, and reactivity, would depend on the compound's detailed molecular interactions and the environment in which it is studied. Further investigation through experimental methods would be necessary to elucidate its full chemical profile.

Formula:C₁₆H₃₁N₃OS₂

InChI:InChI=1S/C16H31N3OS2/c1-3-4-5-6-7-10-14(20)18-11-8-9-13(2)12-19-16(22)15(17)21/h13H,3-12H2,1-2H3,(H2,17,21)(H,18,20)(H,19,22)

InChI key:InChIKey=SBKUIOQHQOBSOQ-UHFFFAOYSA-N

SMILES:O=C(NCCCC(C)CNC(=S)C(=S)N)CCCCCCC