CAS 139428-48-1: N-[(4-Azido-2,3,5,6-tetrafluorophenyl)methyl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide

Description: N-[(4-Azido-2,3,5,6-tetrafluorophenyl)methyl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide, with CAS number 139428-48-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring and an azido group. The presence of the azido functional group suggests potential applications in click chemistry and bioconjugation due to its ability to undergo reactions that form stable linkages with various biomolecules. The tetrafluorophenyl moiety enhances the compound's electronic properties and may influence its reactivity and solubility. This compound is likely to exhibit unique physical and chemical properties, such as stability under certain conditions, and may be sensitive to light or heat due to the azido group. Its potential applications could span across medicinal chemistry, materials science, and chemical biology, particularly in the development of novel therapeutic agents or as a building block in the synthesis of more complex molecules. However, specific safety and handling guidelines should be followed due to the presence of the azido group, which can be hazardous.

Formula: C₁₄H₉F₄N₅O₃

InChI: InChI=1S/C14H9F4N5O3/c15-10-6(11(16)13(18)14(12(10)17)21-22-19)5-20-7(24)3-4-23-8(25)1-2-9(23)26/h1-2H,3-5H2,(H,20,24)

InChI key: InChIKey=QHTHQICZOPOYCT-UHFFFAOYSA-N

SMILES: [N-]=[N+]=NC1=C(F)C(F)=C(C(F)=C1F)CNC(=O)CCN2C(=O)C=CC2=O

Synonyms:

• 1H-Pyrrole-1-propanamide, N-[(4-azido-2,3,5,6-tetrafluorophenyl)methyl]-2,5-dihydro-2,5-dioxo-
• N-[(4-Azido-2,3,5,6-tetrafluorophenyl)methyl]-2,5-dihydro-2,5-dioxo-1H-pyrrole-1-propanamide

1H-Pyrrole-1-propanamide, N-[(4-azido-2,3,5,6-tetrafluorophenyl)methyl]-2,5-dihydro-2,5-dioxo-

CAS: 139428-48-1

• Formula: C₁₄H₉F₄N₅O₃
• Molecular weight: 371.2466