CAS 139458-30-3: (3-METHYLISOXAZOL-4-YL)METHANAMINE

Description:(3-Methylisoxazol-4-yl)methanamine, with the CAS number 139458-30-3, is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a methyl group at the 3-position of the isoxazole ring contributes to its unique properties, while the methanamine functional group introduces basic amine characteristics. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amine group, which can engage in hydrogen bonding. Its potential applications may include roles in medicinal chemistry, particularly in the development of pharmaceuticals, owing to the biological activity often associated with isoxazole derivatives. Additionally, the compound's reactivity can be influenced by the functional groups present, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula:C₅H₈N₂O

InChI:InChI=1/C5H8N2O/c1-4-5(2-6)3-8-7-4/h3H,2,6H2,1H3

Synonyms:
C-(3-Methyl-Isoxazol-4-Yl)-Methylaminine

Found 3 products.

Product data	Purity	Price range	Estimated delivery
4-Isoxazolemethanamine, 3-methyl- REF: IN-DA001B1LCAS: 139458-30-3	- - -	To inquire	Thu 27 Mar 25
(3-Methylisoxazol-4-yl)methanamine REF: 10-F221796CAS: 139458-30-3	95.0%	- - -	Discontinued product
(3-Methylisoxazol-4-yl)methanamine REF: 3D-PFA45830CAS: 139458-30-3	Min. 95%	- - -	Discontinued product