CAS 139591-04-1: 1-(2-Propyn-1-yl)-2-(trifluoromethyl)-1H-benzimidazole

Description: 1-(2-Propyn-1-yl)-2-(trifluoromethyl)-1H-benzimidazole is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a propynyl group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The propynyl substituent introduces a degree of unsaturation, which may affect the compound's reactivity and stability. This compound is likely to exhibit properties typical of benzimidazole derivatives, such as potential antimicrobial or antifungal activity, and may also serve as a building block in the synthesis of more complex molecules. Its molecular structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, the trifluoromethyl group can impart unique electronic properties, making it a valuable component in drug design and development. Overall, this compound represents a versatile structure with potential applications in pharmaceuticals and agrochemicals.

Formula: C₁₁H₇F₃N₂

InChI: InChI=1S/C11H7F3N2/c1-2-7-16-9-6-4-3-5-8(9)15-10(16)11(12,13)14/h1,3-6H,7H2

InChI key: InChIKey=BGVAOBAJEPPXHE-UHFFFAOYSA-N

SMILES: FC(F)(F)C1=NC=2C=CC=CC2N1CC#C

1-(2-Propynyl)-2-(trifluoromethyl)-1H-1,3-benzimidazole

CAS: 139591-04-1

Versatile small molecule scaffold

• Formula: C₁₁H₇F₃N₂
• Purity: Min. 95%
• Molecular weight: 224.18 g/mol

1-(Prop-2-yn-1-yl)-2-(trifluoromethyl)-1h-1,3-benzodiazole

CAS: 139591-04-1

• Purity: 90%
• Molecular weight: 224.18600463867188