CAS 139719-68-9: 1-(1-hydroxycyclohexyl)-3-phenylpropan-1-one
Description:1-(1-Hydroxycyclohexyl)-3-phenylpropan-1-one, also known by its CAS number 139719-68-9, is a chemical compound that belongs to the class of ketones. It features a cyclohexyl group and a phenyl group, contributing to its unique structural characteristics. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and fine chemicals. Its molecular structure includes a hydroxyl group, which can influence its reactivity and solubility in different solvents. The presence of both aliphatic and aromatic components suggests that it may exhibit interesting physical properties, such as moderate volatility and potential for hydrogen bonding. Additionally, due to its functional groups, it may participate in various chemical reactions, including oxidation and substitution reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound is of interest in both academic research and industrial applications.
Formula:C15H20O2
InChI:InChI=1/C15H20O2/c16-14(15(17)11-5-2-6-12-15)10-9-13-7-3-1-4-8-13/h1,3-4,7-8,17H,2,5-6,9-12H2
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Propanone, 1-(1-hydroxycyclohexyl)-3-phenyl- REF: IN-DA001BKOCAS: 139719-68-9 | - - - | To inquire | Mon 17 Mar 25 |
![]() | 1-(1-hydroxycyclohexyl)-3-phenylpropan-1-one REF: 10-F313923CAS: 139719-68-9 | 95.0% | - - - | Discontinued product |
![]() | 1-(1-Hydroxycyclohexyl)-3-phenylpropan-1-one REF: 3D-PFA71968CAS: 139719-68-9 | Min. 95% | - - - | Discontinued product |

1-Propanone, 1-(1-hydroxycyclohexyl)-3-phenyl-
Ref: IN-DA001BKO
Undefined size | To inquire |

1-(1-hydroxycyclohexyl)-3-phenylpropan-1-one
Ref: 10-F313923
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

1-(1-Hydroxycyclohexyl)-3-phenylpropan-1-one
Ref: 3D-PFA71968
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
500mg | Discontinued | Request information |