CAS 139927-86-9: 3,7-Dihydro-3,7-bis(phenylmethyl)-1H-purine-2,6-dione

Description:3,7-Dihydro-3,7-bis(phenylmethyl)-1H-purine-2,6-dione, with the CAS number 139927-86-9, is a synthetic compound belonging to the purine class of molecules. This substance features a purine core structure, which is characterized by a fused bicyclic ring system containing nitrogen atoms. The presence of two phenylmethyl groups at the 3 and 7 positions enhances its lipophilicity and may influence its biological activity. As a purine derivative, it may exhibit properties relevant to nucleic acid metabolism or enzyme inhibition. The compound is likely to be a solid at room temperature and may have moderate solubility in organic solvents. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. However, specific biological activities, toxicity, and pharmacokinetic properties would require further investigation through empirical studies. Overall, this compound represents a structurally interesting entity within the realm of purine chemistry, with potential implications in drug design and development.

Formula:C₁₉H₁₆N₄O₂

InChI:InChI=1S/C19H16N4O2/c24-18-16-17(20-13-22(16)11-14-7-3-1-4-8-14)23(19(25)21-18)12-15-9-5-2-6-10-15/h1-10,13H,11-12H2,(H,21,24,25)

InChI key:InChIKey=GMANCBOGUXSDSL-UHFFFAOYSA-N

SMILES:O=C1NC(=O)N(C=2N=CN(C12)CC=3C=CC=CC3)CC=4C=CC=CC4