CAS 13993-61-8: 1,2,3,4-TETRAHYDRO-1,5-NAPHTHYRIDINE
Description:1,2,3,4-Tetrahydro-1,5-naphthyridine is a bicyclic organic compound characterized by its fused ring structure, which includes a naphthyridine moiety. This compound features a saturated tetrahydro configuration, indicating the presence of four hydrogen atoms added to the naphthyridine framework, resulting in a more stable, saturated structure. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential applications in medicinal chemistry, particularly as a building block for pharmaceuticals due to its ability to interact with biological targets. Its molecular structure contributes to its properties, including solubility in organic solvents and moderate stability under standard conditions. Additionally, it may exhibit biological activity, making it of interest in drug development and research. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H10N2
InChI:InChI=1/C8H10N2/c1-3-7-8(9-5-1)4-2-6-10-7/h1,3,5,10H,2,4,6H2
