CAS 1400645-30-8: Methyl 1-cyclopentyl-1H-benzotriazole-5-carboxylate

Description: Methyl 1-cyclopentyl-1H-benzotriazole-5-carboxylate is an organic compound characterized by its unique structure, which includes a benzotriazole moiety fused with a cyclopentyl group and a carboxylate functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under various conditions, making it suitable for applications in fields like materials science and organic synthesis. The presence of the benzotriazole unit suggests that it may possess UV-absorbing properties, which can be advantageous in formulations requiring protection from ultraviolet light. Additionally, the methyl ester functionality may influence its reactivity and interactions with other chemical species. Overall, this compound's distinct structural features contribute to its potential utility in various chemical applications, including as a building block in the synthesis of more complex molecules or as an additive in polymer formulations. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.

Formula: C₁₃H₁₅N₃O₂

InChI: InChI=1S/C13H15N3O2/c1-18-13(17)9-6-7-12-11(8-9)14-15-16(12)10-4-2-3-5-10/h6-8,10H,2-5H2,1H3

InChI key: InChIKey=IHTGNEMBMFZRCA-UHFFFAOYSA-N

SMILES: O=C(OC)C=1C=CC2=C(N=NN2C3CCCC3)C1

Methyl 1-cyclopentyl-1,2,3-benzotriazole-5-carboxylate

CAS: 1400645-30-8

• Purity: 98%
• Molecular weight: 245.28199768066406

Methyl 1-cyclopentyl-1,2,3-benzotriazole-5-carboxylate

CAS: 1400645-30-8

Please enquire for more information about Methyl 1-cyclopentyl-1,2,3-benzotriazole-5-carboxylate including the price, delivery time and more …

• Formula: C₁₃H₁₅N₃O₂
• Purity: Min. 95%
• Molecular weight: 245.28 g/mol