CAS 14017-54-0: Perchloric acid, holmium(3+) salt

Description:Perchloric acid, holmium(3+) salt, with the CAS number 14017-54-0, is a chemical compound that consists of holmium ions (Ho³⁺) combined with perchlorate ions (ClO₄⁻). This salt typically appears as a crystalline solid and is known for its stability under standard conditions. Holmium is a rare earth element, and its salts often exhibit unique optical and magnetic properties, making them of interest in various scientific applications. Perchlorate ions are known for their strong oxidizing properties, which can influence the reactivity of the compound. The solubility of this salt in water is generally high, allowing it to dissociate into its constituent ions in solution. Due to the presence of perchlorate, safety precautions should be taken, as perchlorates can be hazardous and may pose risks of combustion or explosion under certain conditions. Overall, this compound is utilized in specialized applications, including research in materials science and analytical chemistry.

Formula:ClHO₄Ho

InChI:InChI=1S/ClHO4.Ho/c2-1(3,4)5;/h(H,2,3,4,5);

InChI key:InChIKey=NAPLRINJJNHORH-UHFFFAOYSA-N

SMILES:[Ho].O=Cl(=O)(=O)O

Synonyms:
Holmium Perchlorate
Holmium Triperchlorate Hexahydrate
Holmium perchlorate (Ho(ClO<sub>4</sub>)<sub>3</sub>)
Holmium triperchlorate
Holmium(3+) perchlorate
Perchloric acid, holmium(3+) salt
Holmium perchlorate (Ho(ClO4)3)

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Holmium(III) perchlorate, 50% w/w aq. soln., Reagent Grade REF: 02-040575CAS: 14017-54-0	- - -	To inquire	Fri 21 Mar 25
	Perchloric acid, holmium(3+) salt (8CI,9CI) REF: IN-DA001C3JCAS: 14017-54-0	%	To inquire	Thu 27 Mar 25