CAS 1403233-69-1: 4,5-Dihydro-4-oxo-6-(2-thienyl)[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylic acid

Description:4,5-Dihydro-4-oxo-6-(2-thienyl)[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a fused triazole and pyrazine ring system. This compound features a thienyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of a carboxylic acid functional group suggests that it may exhibit acidic behavior and participate in hydrogen bonding, which can influence its solubility and reactivity. The compound's molecular framework may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its structural features may also impart specific electronic properties, affecting its reactivity and stability. As a relatively specialized compound, it may not be widely studied, but its unique characteristics could make it a candidate for further research in drug development or materials science. Overall, 4,5-Dihydro-4-oxo-6-(2-thienyl)[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylic acid exemplifies the diversity of heterocyclic compounds in organic chemistry.

Formula:C₁₀H₆N₄O₃S

InChI:InChI=1S/C10H6N4O3S/c15-9-8-7(10(16)17)12-13-14(8)4-5(11-9)6-2-1-3-18-6/h1-4H,(H,11,15)(H,16,17)

InChI key:InChIKey=ZRIBFRKYBDQYJM-UHFFFAOYSA-N

SMILES:O=C(O)C=1N=NN2C=C(NC(=O)C12)C=3SC=CC3

Synonyms:
[1,2,3]Triazolo[1,5-a]pyrazine-3-carboxylic acid, 4,5-dihydro-4-oxo-6-(2-thienyl)-
4,5-Dihydro-4-oxo-6-(2-thienyl)[1,2,3]triazolo[1,5-a]pyrazine-3-carboxylic acid