CAS 1404192-13-7: 1-(6-Ethoxy-4-pyrimidinyl)-3-piperidinemethanol

Description: 1-(6-Ethoxy-4-pyrimidinyl)-3-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a piperidine moiety. The presence of the ethoxy group on the pyrimidine ring contributes to its solubility and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate polarity due to the hydroxyl group and the ethoxy substituent. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 1404192-13-7, serves as a unique identifier for regulatory and research purposes. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its pharmacological properties and potential therapeutic uses.

Formula: C₁₂H₁₉N₃O₂

InChI: InChI=1S/C12H19N3O2/c1-2-17-12-6-11(13-9-14-12)15-5-3-4-10(7-15)8-16/h6,9-10,16H,2-5,7-8H2,1H3

InChI key: InChIKey=FWWDYRPLICJLGT-UHFFFAOYSA-N

SMILES: OCC1CN(C=2N=CN=C(OCC)C2)CCC1

Synonyms:

• 1-(6-Ethoxy-4-pyrimidinyl)-3-piperidinemethanol
• 3-Piperidinemethanol, 1-(6-ethoxy-4-pyrimidinyl)-

(1-(6-Ethoxypyrimidin-4-yl)piperidin-3-yl)methanol

CAS: 1404192-13-7

• Purity: 95%
• Molecular weight: 237.30299377441406

[1-(6-Ethoxy-pyrimidin-4-yl)-piperidin-3-yl]-methanol

CAS: 1404192-13-7

Please enquire for more information about [1-(6-Ethoxy-pyrimidin-4-yl)-piperidin-3-yl]-methanol including the price, delivery time and more detailed …

• Formula: C₁₂H₁₉N₃O₂
• Purity: Min. 95%
• Molecular weight: 237.3 g/mol