CAS 140675-43-0: 2-Cyano-3-fluorophenol

Description:2-Cyano-3-fluorophenol is an organic compound characterized by the presence of both a cyano group (-C≡N) and a fluorine atom attached to a phenolic structure. This compound features a hydroxyl group (-OH) that contributes to its classification as a phenol. The cyano group introduces significant polarity and can enhance the compound's reactivity, making it useful in various chemical syntheses. The fluorine atom, known for its electronegativity, can influence the compound's electronic properties and stability. 2-Cyano-3-fluorophenol is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the hydroxyl group. Its unique combination of functional groups allows it to participate in diverse chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many chemical substances, handling should be done with care, considering potential toxicity and environmental impact.

Formula:C₇H₄FNO

InChI:InChI=1S/C7H4FNO/c8-6-2-1-3-7(10)5(6)4-9/h1-3,10H

InChI key:InChIKey=YEBHNFDMNFHZFF-UHFFFAOYSA-N

SMILES:N#CC=1C(F)=CC=CC1O

Synonyms:
2-Cyano-3-fluorophenol
2-Fluoro-6-Hydroxybenzonitrle
6-Fluoro-2-hydroxybenzonitrile
Benzonitrile, 2-fluoro-6-hydroxy-
2-Fluoro-6-hydroxybenzonitrile

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Fluoro-6-hydroxybenzonitrile REF: 3B-F0985CAS: 140675-43-0	>98.0%(GC)(T)	36.00 €~99.00 €	Thu 20 Mar 25
Benzonitrile, 2-fluoro-6-hydroxy- REF: IN-DA001COGCAS: 140675-43-0	97%	25.00 €~166.00 €	Thu 27 Mar 25
2-Fluoro-6-hydroxybenzonitrile REF: 54-PC10435CAS: 140675-43-0	99%	32.00 €~53.00 €	Fri 28 Mar 25
2-Fluoro-6-hydroxybenzonitrile REF: 10-F013036CAS: 140675-43-0	98.0%	To inquire	Tue 08 Apr 25
2-Fluoro-6-hydroxybenzonitrile REF: 3D-FF64144CAS: 140675-43-0	Min. 95%	185.00 €~1,071.00 €	Thu 08 May 25