CAS 141030-72-0: cyclopropyl(2-fluorophenyl)methanone

Description:Cyclopropyl(2-fluorophenyl)methanone is an organic compound characterized by the presence of a cyclopropyl group and a 2-fluorophenyl moiety attached to a carbonyl functional group (ketone). This compound features a three-membered cyclopropyl ring, which contributes to its unique reactivity and strain. The 2-fluorophenyl group indicates the presence of a fluorine atom on the second carbon of the phenyl ring, which can influence the compound's electronic properties and reactivity. Cyclopropyl(2-fluorophenyl)methanone is likely to exhibit interesting chemical behavior due to the combination of the strained cyclopropyl ring and the electron-withdrawing fluorine atom, which can affect its stability and interaction with other chemical species. This compound may be of interest in medicinal chemistry and materials science, where such structural features can lead to novel biological activities or material properties. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall structure.

Formula:C₁₀H₉FO

InChI:InChI=1/C10H9FO/c11-9-4-2-1-3-8(9)10(12)7-5-6-7/h1-4,7H,5-6H2

Synonyms:
Methanone, Cyclopropyl(2-Fluorophenyl)-
Cyclopropyl(2-fluorophenyl)methanone

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	Cyclopropyl 2-fluorophenyl ketone REF: 10-F204040CAS: 141030-72-0	97.0%	257.00 €~946.00 €	Tue 01 Apr 25
	Cyclopropyl(2-Fluorophenyl)Methanone REF: 3D-FC83016CAS: 141030-72-0	Min. 95%	- - -	Discontinued product