CAS 14135-63-8: 2-Phenyl-3(2H)-pyridazinone

Description:2-Phenyl-3(2H)-pyridazinone, with the CAS number 14135-63-8, is a heterocyclic organic compound characterized by its pyridazinone core structure, which features a pyridazine ring fused with a carbonyl group and a phenyl substituent. This compound typically exhibits a pale yellow to light brown crystalline appearance. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the phenyl group enhances its lipophilicity, which can influence its bioavailability and interaction with biological targets. Additionally, 2-Phenyl-3(2H)-pyridazinone may participate in various chemical reactions due to the reactivity of the carbonyl group, allowing for further derivatization. Its solubility can vary depending on the solvent, and it is generally stable under standard laboratory conditions. As with many heterocycles, the compound's properties can be influenced by substituents and the overall molecular environment, making it a versatile candidate for further study in medicinal chemistry and related fields.

Formula:C₁₀H₈N₂O

InChI:InChI=1/C10H8N2O/c13-10-7-4-8-11-12(10)9-5-2-1-3-6-9/h1-8H

Synonyms:
Ppyz
3(2H)-Pyridazinone, 2-phenyl-
2-phenylpyridazin-3(2H)-one

Found 3 products.

Product data	Purity	Price range	Estimated delivery
3(2H)-Pyridazinone, 2-phenyl- REF: IN-DA001GA0CAS: 14135-63-8	- - -	To inquire	Thu 27 Mar 25
2-Phenyl-2,3-dihydropyridazin-3-one REF: 3D-PAA13563CAS: 14135-63-8	Min. 95%	To inquire	Thu 08 May 25
2-Phenylpyridazin-3(2H)-one REF: 10-F769458CAS: 14135-63-8	98%	- - -	Discontinued product