CAS 141412-60-4: 1,4-DIFLUORO-2-METHYL-5-NITROBENZENE

Description:1,4-Difluoro-2-methyl-5-nitrobenzene is an aromatic compound characterized by the presence of two fluorine atoms, a methyl group, and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the 5-position, a methyl group (-CH3) at the 2-position, and fluorine substituents at the 1 and 4 positions of the benzene ring. This compound is typically a yellow to orange solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its fluorine substituents contribute to its chemical stability and influence its reactivity, making it a valuable compound in various chemical reactions. Additionally, the nitro group can participate in electrophilic aromatic substitution reactions, further expanding its utility in synthetic chemistry. Safety data should be consulted for handling, as nitro compounds can be hazardous.

Formula:C₇H₅F₂NO₂

InChI:InChI=1/C7H5F2NO2/c1-4-2-6(9)7(10(11)12)3-5(4)8/h2-3H,1H3

Synonyms:
2,5-Difluoro-4-methylnitrobenzene
2,5-Difluoro-4-nitrotoluene
2,5-Difluoro-4-methyinitrobenzene

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2,5-Difluoro-4-nitrotoluene REF: 3B-D4806CAS: 141412-60-4	>98.0%(GC)	46.00 €~177.00 €	Thu 20 Mar 25
1,4-Difluoro-2-methyl-5-nitrobenzene REF: IN-DA003DOBCAS: 141412-60-4	98%	21.00 €~187.00 €	Thu 27 Mar 25
2,5-Difluoro-4-nitrotoluene REF: 54-PC10366CAS: 141412-60-4	- - -	32.00 €~229.00 €	Fri 28 Mar 25
1,4-Difluoro-2-methyl-5-nitrobenzene REF: 10-F077785CAS: 141412-60-4	95.0%	To inquire	Tue 08 Apr 25
1,4-difluoro-2-methyl-5-nitrobenzene REF: 3D-FD104889CAS: 141412-60-4	Min. 95%	- - -	Discontinued product