CAS 141428-47-9: (2,3-difluoro-6-nitrophenyl)acetic acid

Description:(2,3-Difluoro-6-nitrophenyl)acetic acid is an organic compound characterized by its aromatic structure, which includes a phenyl ring substituted with two fluorine atoms and a nitro group, along with an acetic acid functional group. The presence of the difluoro and nitro substituents significantly influences its chemical properties, including its reactivity and polarity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its fluorine atoms contribute to unique electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The nitro group can serve as a strong electron-withdrawing group, affecting the acidity of the carboxylic acid moiety. Additionally, (2,3-difluoro-6-nitrophenyl)acetic acid may have applications in pharmaceuticals or agrochemicals, where such functional groups can impart desirable biological activity. Safety data should be consulted for handling and potential hazards, as compounds with nitro and fluorine substituents can pose specific risks.

Formula:C₈H₅F₂NO₄

InChI:InChI=1/C8H5F2NO4/c9-5-1-2-6(11(14)15)4(8(5)10)3-7(12)13/h1-2H,3H2,(H,12,13)

Synonyms:
Benzeneacetic Acid, 2,3-Difluoro-6-Nitro-
2,3-difluoro-6-nitrophenylacetic acid
(2,3-Difluoro-6-nitrophenyl)acetic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,3-Difluoro-6-nitrophenylacetic Acid REF: 3B-D4583CAS: 141428-47-9	>98.0%(GC)(T)	66.00 €~201.00 €	Thu 20 Mar 25
Benzeneacetic acid, 2,3-difluoro-6-nitro- REF: IN-DA001GCZCAS: 141428-47-9	98%	60.00 €~532.00 €	Thu 27 Mar 25
2-(2,3-Difluoro-6-nitrophenyl)acetic acid REF: 10-F227967CAS: 141428-47-9	95.0%	To inquire	Tue 08 Apr 25
2,3-Difluoro-6-nitrobenzeneacetic acid REF: 3D-FD100331CAS: 141428-47-9	Min. 95%	- - -	Discontinued product