
CAS 1415559-93-1: Methyl 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-1-methyl-1H-benzimidazole-6-carboxylate
Description:Methyl 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-1-methyl-1H-benzimidazole-6-carboxylate is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with various functional groups. The presence of a methyl ester group indicates that it is likely to be a polar compound, which may influence its solubility in organic solvents and water. The bromine and fluorine substituents on the aromatic ring contribute to its electronic properties, potentially enhancing its reactivity and biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of multiple halogens may affect its stability and environmental behavior. Overall, this compound represents a class of heterocyclic compounds that are of significant interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C16H12BrF2N3O2
InChI:InChI=1S/C16H12BrF2N3O2/c1-22-7-20-15-12(22)6-9(16(23)24-2)14(13(15)19)21-11-4-3-8(17)5-10(11)18/h3-7,21H,1-2H3
InChI key:InChIKey=CLBKHICAWHYQLM-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC2=C(N=CN2C)C(F)=C1NC3=CC=C(Br)C=C3F
- Synonyms:
- Methyl 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-1-methyl-1H-benzimidazole-6-carboxylate
- 1H-Benzimidazole-6-carboxylic acid, 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-1-methyl-, methyl ester

1H-Benzimidazole-6-carboxylic acid, 5-[(4-bromo-2-fluorophenyl)amino]-4-fluoro-1-methyl-, methyl ester
Ref: IN-DA01D8VY
100mg | To inquire | ||
250mg | To inquire |

methyl 5-((4-bromo-2-fluorophenyl)amino)-4-fluoro-1-methyl-1H-benzo[d]imidazole-6-carboxylate
Ref: 54-PC103080
100mg | 793.00 € |

Ref: 4Z-B-207007
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |