CAS 1416714-48-1: 3,5-Difluoro-4-pyridinemethanamine

Description:3,5-Difluoro-4-pyridinemethanamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of two fluorine atoms at the 3 and 5 positions of the pyridine ring contributes to its unique chemical properties, including increased electronegativity and potential for hydrogen bonding. The amine functional group (-NH2) at the 4-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit polar characteristics due to the electronegative fluorine atoms and the amine group, influencing its solubility in polar solvents. Additionally, the presence of fluorine can enhance the compound's stability and lipophilicity, which may be beneficial in pharmaceutical applications. Overall, 3,5-Difluoro-4-pyridinemethanamine is of interest in medicinal chemistry and material science due to its unique structural features and potential biological activity.

Formula:C₆H₆F₂N₂

InChI:InChI=1S/C6H6F2N2/c7-5-2-10-3-6(8)4(5)1-9/h2-3H,1,9H2

InChI key:InChIKey=FEDGPLHAUHSNPW-UHFFFAOYSA-N

SMILES:FC1=CN=CC(F)=C1CN

Synonyms:
(3,5-Difluoropyridin-4-yl)methanamine
3,5-Difluoro-4-pyridinemethanamine
4-Pyridinemethanamine, 3,5-difluoro-
4-Aminomethyl-3,5-difluoropyridine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Pyridinemethanamine, 3,5-difluoro- REF: IN-DA00LTC5CAS: 1416714-48-1	95%	To inquire	Wed 12 Mar 25
(3,5-Difluoropyridin-4-yl)methanamine REF: 54-PC100770CAS: 1416714-48-1	95%	244.00 €~4,227.00 €	Thu 13 Mar 25
(3,5-Difluoropyridin-4-yl)methanamine REF: 10-F699711CAS: 1416714-48-1	98%	128.00 €~3,223.00 €	Mon 17 Mar 25
(3,5-Difluoropyridin-4-yl)methanamine REF: 3D-RGC71448CAS: 1416714-48-1	Min. 95%	- - -	Discontinued product