CAS 141675-48-1: (3R,4R,5R,6R)-6-[(1,2-dimethyl-4-oxo-3-pyridyl)oxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid
Description:The chemical substance known as (3R,4R,5R,6R)-6-[(1,2-dimethyl-4-oxo-3-pyridyl)oxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic acid, with the CAS number 141675-48-1, is a complex organic compound characterized by its tetrahydropyran structure, which features multiple hydroxyl groups that contribute to its hydrophilicity and potential for forming hydrogen bonds. The presence of a pyridine moiety, specifically a 1,2-dimethyl-4-oxo group, indicates potential biological activity, possibly influencing its interaction with biological targets. This compound may exhibit properties such as solubility in polar solvents and the ability to participate in various chemical reactions due to its functional groups. Its stereochemistry, denoted by the (3R,4R,5R,6R) configuration, suggests specific spatial arrangements that could affect its reactivity and biological interactions. Overall, this substance may have applications in pharmaceuticals or biochemistry, although specific biological activities and applications would require further investigation.
Formula:C13H17NO8
InChI:InChI=1/C13H17NO8/c1-5-10(6(15)3-4-14(5)2)21-13-9(18)7(16)8(17)11(22-13)12(19)20/h3-4,7-9,11,13,16-18H,1-2H3,(H,19,20)/t7-,8-,9-,11?,13+/m1/s1
![(3R,4R,5R,6R)-6-[(1,2-dimethyl-4-oxo-3-pyridyl)oxy]-3,4,5-trihydroxy-tetrahydropyran-2-carboxylic …](https://static.cymitquimica.com/cas-image/320272-3r-4r-5r-6r-6-12-dimethyl-4-oxo-3-pyridyl-oxy-345-trihydroxy-tetrahydropyran-2-carboxylic-acid.png)
