CAS 1418117-83-5: Methyl 5-ethoxy-2-thiophenecarboxylate

Description:Methyl 5-ethoxy-2-thiophenecarboxylate is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an ethoxy group and a carboxylate functional group, contributing to its reactivity and solubility properties. Typically, compounds like this exhibit moderate polarity due to the presence of both hydrophobic (the thiophene and ethoxy groups) and hydrophilic (the carboxylate group) components. Methyl 5-ethoxy-2-thiophenecarboxylate may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique structure allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the ethoxy group can enhance its solubility in organic solvents, facilitating its use in various chemical reactions. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.

Formula:C₈H₁₀O₃S

InChI:InChI=1S/C8H10O3S/c1-3-11-7-5-4-6(12-7)8(9)10-2/h4-5H,3H2,1-2H3

InChI key:InChIKey=YPAFCTAYJXFBHQ-UHFFFAOYSA-N

SMILES:O=C(OC)C=1SC(OCC)=CC1

Synonyms:
Methyl 5-ethoxy-2-thiophenecarboxylate
2-Thiophenecarboxylic acid, 5-ethoxy-, methyl ester

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Thiophenecarboxylic acid, 5-ethoxy-, methyl ester REF: IN-DA001H80CAS: 1418117-83-5	- - -	To inquire	Thu 27 Mar 25
Methyl 5-Ethoxy-2-thiophenecarboxylate REF: 54-OR470579CAS: 1418117-83-5	- - -	To inquire	Thu 03 Apr 25
Methyl 5-ethoxythiophene-2-carboxylate REF: 10-F733720CAS: 1418117-83-5	95+%	- - -	Discontinued product
Methyl 5-ethoxy-2-thiophenecarboxylate REF: 3D-TGC11783CAS: 1418117-83-5	Min. 95%	- - -	Discontinued product