CAS 1420792-15-9: 5-Bromo-6-fluoro-8-methyl-2-quinolinecarboxylic acid

Description:5-Bromo-6-fluoro-8-methyl-2-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromine atom at the 5-position, a fluorine atom at the 6-position, and a methyl group at the 8-position of the quinoline ring, along with a carboxylic acid functional group at the 2-position. The presence of these halogen substituents can influence the compound's reactivity, solubility, and biological activity. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The carboxylic acid group contributes to the compound's acidity and potential for forming salts or esters. Additionally, the unique combination of halogens and the methyl group can affect the compound's electronic properties and steric hindrance, which may play a role in its interactions with biological targets. Overall, this compound represents a specific class of heterocyclic compounds with potential applications in drug development and other fields of chemistry.

Formula:C₁₁H₇BrFNO₂

InChI:InChI=1S/C11H7BrFNO2/c1-5-4-7(13)9(12)6-2-3-8(11(15)16)14-10(5)6/h2-4H,1H3,(H,15,16)

InChI key:InChIKey=OVBHEWUPXIYCPT-UHFFFAOYSA-N

SMILES:O=C(O)C=1N=C2C(=CC1)C(Br)=C(F)C=C2C