CAS 1420792-56-8: 5-Amino-N-methyl-2-(1H-pyrazol-1-yl)benzamide

Description:5-Amino-N-methyl-2-(1H-pyrazol-1-yl)benzamide is an organic compound characterized by its complex structure, which includes an amine group, a methyl group, and a pyrazole moiety attached to a benzamide framework. This compound typically exhibits properties such as solubility in polar solvents due to the presence of the amine and carbonyl functional groups, which can engage in hydrogen bonding. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyrazole ring may contribute to its pharmacological properties, as pyrazoles are known for their diverse biological activities. Additionally, the compound may exhibit moderate stability under standard laboratory conditions, although specific reactivity can depend on the surrounding environment and the presence of other chemical species. Overall, 5-Amino-N-methyl-2-(1H-pyrazol-1-yl)benzamide represents a versatile scaffold for further chemical modifications and investigations into its potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula:C₁₁H₁₂N₄O

InChI:InChI=1S/C11H12N4O/c1-13-11(16)9-7-8(12)3-4-10(9)15-6-2-5-14-15/h2-7H,12H2,1H3,(H,13,16)

InChI key:InChIKey=BPIVKWSZAVDXBY-UHFFFAOYSA-N

SMILES:O=C(NC)C1=CC(N)=CC=C1N2N=CC=C2

Synonyms:
Benzamide, 5-amino-N-methyl-2-(1H-pyrazol-1-yl)-
5-Amino-N-methyl-2-(1H-pyrazol-1-yl)benzamide

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	5-Amino-N-methyl-2-(1H-pyrazol-1-yl)benzamide REF: 10-F731540CAS: 1420792-56-8	97%	- - -	Discontinued product
	5-Amino-N-methyl-2-(1H-pyrazol-1-yl)benzamide REF: 3D-VGC79256CAS: 1420792-56-8	Min. 95%	- - -	Discontinued product