CAS 142141-37-5: 2-AMINO-N-CYCLOPENTYLBENZAMIDE
Description:2-Amino-N-cyclopentylbenzamide is an organic compound characterized by the presence of an amino group and a cyclopentyl group attached to a benzamide structure. This compound features a benzene ring substituted with an amide functional group, which is further substituted with a cyclopentyl group at the nitrogen atom. The amino group contributes to its basicity and potential reactivity, making it of interest in various chemical and pharmaceutical applications. The cyclopentyl moiety introduces a degree of steric hindrance, which can influence the compound's interaction with biological targets. Typically, compounds like 2-amino-N-cyclopentylbenzamide may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and potential biological activity, which could be explored in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to specialized databases for precise values.
Formula:C12H16N2O
InChI:InChI=1/C12H16N2O/c13-11-8-4-3-7-10(11)12(15)14-9-5-1-2-6-9/h3-4,7-9H,1-2,5-6,13H2,(H,14,15)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzamide, 2-amino-N-cyclopentyl- REF: IN-DA001HUZCAS: 142141-37-5 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-Amino-N-cyclopentylbenzamide REF: 3D-SFA14137CAS: 142141-37-5 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 2-Amino-n-cyclopentylbenzamide REF: 10-F648767CAS: 142141-37-5 | 98% | - - - | Discontinued product |

Ref: IN-DA001HUZ
Undefined size | To inquire |

2-Amino-N-cyclopentylbenzamide
Ref: 3D-SFA14137
5g | 1,845.00 € | ||
500mg | 531.00 € |

Ref: 10-F648767
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |