CAS 1422343-90-5: 1,1-Dimethylethyl 3-[[[(phenylmethoxy)carbonyl]amino]methyl]-2-oxa-9-azaspiro[5.5]undecane-9-carboxylate
Description:1,1-Dimethylethyl 3-[[[(phenylmethoxy)carbonyl]amino]methyl]-2-oxa-9-azaspiro[5.5]undecane-9-carboxylate, with the CAS number 1422343-90-5, is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a dimethyl group that enhances its steric properties, potentially influencing its reactivity and solubility. The presence of a phenylmethoxycarbonyl group suggests that it may exhibit significant lipophilicity, which could affect its biological activity and interaction with cellular membranes. The oxaspiro and azaspiro frameworks contribute to its rigidity and may play a role in its pharmacological properties. Additionally, the carboxylate functional group indicates potential for ionic interactions, which could be relevant in biological systems. Overall, this compound's structural complexity and functional groups suggest it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C23H34N2O5
InChI:InChI=1S/C23H34N2O5/c1-22(2,3)30-21(27)25-13-11-23(12-14-25)10-9-19(29-17-23)15-24-20(26)28-16-18-7-5-4-6-8-18/h4-8,19H,9-17H2,1-3H3,(H,24,26)
InChI key:InChIKey=INQHZVJEFRHVNB-UHFFFAOYSA-N
SMILES:O=C(OCC=1C=CC=CC1)NCC2OCC3(CCN(C(=O)OC(C)(C)C)CC3)CC2
- Synonyms:
- 1,1-Dimethylethyl 3-[[[(phenylmethoxy)carbonyl]amino]methyl]-2-oxa-9-azaspiro[5.5]undecane-9-carboxylate
- 2-Oxa-9-azaspiro[5.5]undecane-9-carboxylic acid, 3-[[[(phenylmethoxy)carbonyl]amino]methyl]-, 1,1-dimethylethyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Tert-butyl 3-((((benzyloxy)carbonyl)amino)methyl)-2-oxa-9-azaspiro[5.5]Undecane-9-carboxylate REF: 10-F769743CAS: 1422343-90-5 | 98% | - - - | Discontinued product |
![]() | Tert-Butyl 3-Benzyloxy)Carbonyl)Amino)Methyl)-2-Oxa-9-Azaspiro[5.5]Undecane-9-Carboxylate REF: 3D-XGC34390CAS: 1422343-90-5 | Min. 95% | - - - | Discontinued product |

Tert-butyl 3-((((benzyloxy)carbonyl)amino)methyl)-2-oxa-9-azaspiro[5.5]Undecane-9-carboxylate
Ref: 10-F769743
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

Tert-Butyl 3-Benzyloxy)Carbonyl)Amino)Methyl)-2-Oxa-9-Azaspiro[5.5]Undecane-9-Carboxylate
Ref: 3D-XGC34390
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |