CAS 1423032-14-7: 5-(2-Furanyl)-4-isoxazolecarboxylic acid

Description: 5-(2-Furanyl)-4-isoxazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a furan ring and an isoxazole moiety. The presence of these heterocyclic rings contributes to its potential biological activity and chemical reactivity. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for carboxylic acids due to their ability to form hydrogen bonds. The isoxazole ring, known for its aromaticity, may impart stability and influence the compound's interaction with biological targets. Additionally, the furan ring can participate in various chemical reactions, including electrophilic substitutions. The carboxylic acid functional group is significant for its acidity and ability to form salts or esters, which can be relevant in medicinal chemistry. Overall, 5-(2-Furanyl)-4-isoxazolecarboxylic acid is of interest in research for its potential applications in pharmaceuticals and agrochemicals, although specific biological activities and mechanisms would require further investigation.

Formula: C₈H₅NO₄

InChI: InChI=1S/C8H5NO4/c10-8(11)5-4-9-13-7(5)6-2-1-3-12-6/h1-4H,(H,10,11)

InChI key: InChIKey=XDXLFIDTDFTJOT-UHFFFAOYSA-N

SMILES: O=C(O)C=1C=NOC1C=2OC=CC2

Synonyms:

• 4-Isoxazolecarboxylic acid, 5-(2-furanyl)-
• 5-(2-Furanyl)-4-isoxazolecarboxylic acid

5-(Furan-2-yl)-1,2-oxazole-4-carboxylic acid

CAS: 1423032-14-7

Versatile small molecule scaffold

• Formula: C₈H₅NO₄
• Purity: Min. 95%
• Molecular weight: 179.13 g/mol

5-(Furan-2-yl)-1,2-oxazole-4-carboxylic acid

CAS: 1423032-14-7

• Purity: 95%
• Molecular weight: 179.13099670410156