CAS 1423032-20-5: Cycloheptanamine, 1-[5-(tetrahydro-2-furanyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

Description: Cycloheptanamine, 1-[5-(tetrahydro-2-furanyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cycloheptane ring and an oxadiazole moiety. The presence of the tetrahydro-2-furanyl group contributes to its potential biological activity, as furan derivatives are often associated with various pharmacological properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for drug development, particularly in the context of neuropharmacology or other therapeutic areas. Its molecular interactions, stability, and reactivity would be influenced by the functional groups present, making it a subject of interest for further research in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₂₁N₃O₂·ClH

InChI: InChI=1S/C13H21N3O2.ClH/c14-13(7-3-1-2-4-8-13)12-15-11(18-16-12)10-6-5-9-17-10;/h10H,1-9,14H2;1H

InChI key: InChIKey=KCSVOQIKWIIGOH-UHFFFAOYSA-N

SMILES: Cl.N=1OC(=NC1C2(N)CCCCCC2)C3OCCC3

Synonyms:

• Cycloheptanamine, 1-[5-(tetrahydro-2-furanyl)-1,2,4-oxadiazol-3-yl]-, hydrochloride (1:1)

1-[5-(Oxolan-2-yl)-1,2,4-oxadiazol-3-yl]cycloheptan-1-amine hydrochloride

CAS: 1423032-20-5

Versatile small molecule scaffold

• Formula: C₁₃H₂₂ClN₃O₂
• Purity: Min. 95%
• Molecular weight: 287.78 g/mol

1-[5-(oxolan-2-yl)-1,2,4-oxadiazol-3-yl]cycloheptan-1-amine hydrochloride

CAS: 1423032-20-5

• Purity: 98%
• Molecular weight: 287.7900085449219