CAS 1423033-43-5: 2-Oxaspiro[3.3]heptane-6-carboxylic acid, 6-cyano-, methyl ester

Description: 2-Oxaspiro[3.3]heptane-6-carboxylic acid, 6-cyano-, methyl ester is a chemical compound characterized by its unique spirocyclic structure, which features a bicyclic framework with an ether linkage. This compound contains a carboxylic acid functional group and a cyano group, contributing to its reactivity and potential applications in organic synthesis. The methyl ester form indicates the presence of a methoxy group, which can influence its solubility and reactivity. The spiro structure often imparts interesting stereochemical properties, making it a subject of interest in medicinal chemistry and materials science. Additionally, the presence of the cyano group can enhance the compound's ability to participate in nucleophilic reactions, potentially leading to the formation of various derivatives. Overall, this compound's unique structural features and functional groups suggest it may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Further studies would be necessary to explore its specific properties, reactivity, and potential uses in various chemical contexts.

Formula: C₉H₁₁NO₃

InChI: InChI=1S/C9H11NO3/c1-12-7(11)9(4-10)2-8(3-9)5-13-6-8/h2-3,5-6H2,1H3

InChI key: InChIKey=MINVJBSZZWVFIH-UHFFFAOYSA-N

SMILES: N#CC1(C(=O)OC)CC2(COC2)C1

Synonyms:

• 2-Oxaspiro[3.3]heptane-6-carboxylic acid, 6-cyano-, methyl ester
• Methyl 6-cyano-2-oxaspiro[3.3]heptane-6-carboxylate

Methyl 6-cyano-2-oxaspiro[3.3]heptane-6-carboxylate

CAS: 1423033-43-5

Versatile small molecule scaffold

• Formula: C₉H₁₁NO₃
• Purity: Min. 95%
• Molecular weight: 181.19 g/mol

Methyl 6-cyano-2-oxaspiro[3.3]heptane-6-carboxylate

CAS: 1423033-43-5

• Purity: 98%
• Molecular weight: 181.1909942626953