CAS 1423037-49-3: Glycine, 2-butoxyethyl ester, 2,2,2-trifluoroacetate (1:1)

Description:Glycine, 2-butoxyethyl ester, 2,2,2-trifluoroacetate (1:1) is a chemical compound characterized by its unique structure, which combines an amino acid derivative with an ester and a trifluoroacetate moiety. This compound typically exhibits properties associated with both glycine and ester functionalities, including potential solubility in polar solvents due to the presence of the butoxyethyl group. The trifluoroacetate component imparts distinct characteristics, such as increased lipophilicity and potential biological activity, which may influence its reactivity and interaction with biological systems. The presence of fluorine atoms often enhances the stability and lipophilicity of the compound, making it of interest in various applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific melting and boiling points, as well as reactivity patterns typical of esters and amino acids. Safety and handling considerations are essential due to the potential toxicity associated with fluorinated compounds. Overall, this compound represents a blend of functionalities that may be explored for diverse chemical and biological applications.

Formula:C₈H₁₇NO₃·C₂HF₃O₂

InChI:InChI=1S/C8H17NO3.C2HF3O2/c1-2-3-4-11-5-6-12-8(10)7-9;3-2(4,5)1(6)7/h2-7,9H2,1H3;(H,6,7)

InChI key:InChIKey=AQMXIJVLMCJBTI-UHFFFAOYSA-N

SMILES:O=C(OCCOCCCC)CN.O=C(O)C(F)(F)F