
CAS 1427195-04-7: 4-(1,1-Difluoroethyl)-5-pyrimidinemethanamine
Description:4-(1,1-Difluoroethyl)-5-pyrimidinemethanamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing nitrogen atoms. The presence of a difluoroethyl group at the 4-position of the pyrimidine ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics influenced by the electronegative fluorine atoms. The amine functional group at the 5-position enhances its basicity and potential for hydrogen bonding, making it a candidate for various chemical reactions and applications in medicinal chemistry. This compound may exhibit biological activity, potentially serving as a lead compound in drug discovery or as an intermediate in the synthesis of more complex molecules. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent. As with many fluorinated compounds, it may also display distinct pharmacokinetic properties, which are important for evaluating its suitability in pharmaceutical applications.
Formula:C7H9F2N3
InChI:InChI=1S/C7H9F2N3/c1-7(8,9)6-5(2-10)3-11-4-12-6/h3-4H,2,10H2,1H3
InChI key:InChIKey=XEKYGFQRDJMXGC-UHFFFAOYSA-N
SMILES:FC(F)(C=1N=CN=CC1CN)C
- Synonyms:
- 5-Pyrimidinemethanamine, 4-(1,1-difluoroethyl)-
- 4-(1,1-Difluoroethyl)-5-pyrimidinemethanamine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [4-(1,1-Difluoroethyl)pyrimidin-5-yl]methanamine REF: 54-PC106259CAS: 1427195-04-7 | - - - | 1,600.00 €~4,293.00 € | Fri 28 Mar 25 |
![]() | (4-(1,1-Difluoroethyl)pyrimidin-5-yl)methanamine REF: 10-F769730CAS: 1427195-04-7 | 98% | - - - | Discontinued product |
![]() | C-[4-(1,1-Difluoro-ethyl)-pyrimidin-5-yl]-methylamine REF: 3D-CHC19504CAS: 1427195-04-7 | Min. 95% | - - - | Discontinued product |

Ref: 54-PC106259
1g | 4,293.00 € | ||
250mg | 1,600.00 € |

(4-(1,1-Difluoroethyl)pyrimidin-5-yl)methanamine
Ref: 10-F769730
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

C-[4-(1,1-Difluoro-ethyl)-pyrimidin-5-yl]-methylamine
Ref: 3D-CHC19504
50mg | Discontinued | Request information | |
500mg | Discontinued | Request information |