CAS 1428243-24-6: 1-(Phenylmethyl) (3R,4S)-4-ethyl-1,3-pyrrolidinedicarboxylate
Description:1-(Phenylmethyl)(3R,4S)-4-ethyl-1,3-pyrrolidinedicarboxylate is a chemical compound characterized by its pyrrolidine backbone, which features two carboxylate groups and a phenylmethyl substituent. The compound exhibits chirality, indicated by the (3R,4S) configuration, which suggests that it has two stereocenters, leading to potential enantiomers with distinct properties. The presence of the ethyl group contributes to its hydrophobic characteristics, while the carboxylate groups enhance its solubility in polar solvents. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its reactivity and binding affinity in biological systems. As with many organic compounds, the stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, this compound's unique structure and properties make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C15H19NO4
InChI:InChI=1S/C15H19NO4/c1-2-12-8-16(9-13(12)14(17)18)15(19)20-10-11-6-4-3-5-7-11/h3-7,12-13H,2,8-10H2,1H3,(H,17,18)/t12-,13+/m1/s1
InChI key:InChIKey=LKPALAXKZXXURJ-OLZOCXBDSA-N
SMILES:O=C(OCC=1C=CC=CC1)N2CC(C(=O)O)C(C2)CC
- Synonyms:
- 1-(Phenylmethyl) (3R,4S)-4-ethyl-1,3-pyrrolidinedicarboxylate
- 1,3-Pyrrolidinedicarboxylic acid, 4-ethyl-, 1-(phenylmethyl) ester, (3R,4S)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1,3-Pyrrolidinedicarboxylic acid, 4-ethyl-, 1-(phenylmethyl) ester, (3R,4S)- REF: IN-DA01X5BUCAS: 1428243-24-6 | 98% | To inquire | Thu 27 Mar 25 |
![]() | Upadacitinib Impurity 1 REF: 4Z-U-103003CAS: 1428243-24-6 | - - - | To inquire | Fri 28 Mar 25 |
![]() | (3R,4S)-1-(Benzyloxycarbonyl)-4- ethylpyrrolidine-3-carboxylicacid REF: 3D-FB170721CAS: 1428243-24-6 | Min. 95% | - - - | Discontinued product |

1,3-Pyrrolidinedicarboxylic acid, 4-ethyl-, 1-(phenylmethyl) ester, (3R,4S)-
Ref: IN-DA01X5BU
1g | 170.00 € | ||
5g | 513.00 € | ||
25g | To inquire | ||
100mg | 50.00 € | ||
250mg | 77.00 € |

Ref: 4Z-U-103003
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |

(3R,4S)-1-(Benzyloxycarbonyl)-4- ethylpyrrolidine-3-carboxylicacid
Ref: 3D-FB170721
1g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |