CAS 1429417-53-7: 1-(2-Fluoroethyl)-1H-pyrazole-5-carboxaldehyde
Description:1-(2-Fluoroethyl)-1H-pyrazole-5-carboxaldehyde is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a carboxaldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The fluorine atom in the 2-fluoroethyl substituent can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. This compound may be of interest in medicinal chemistry and material science due to its unique structural features. Additionally, its properties, such as solubility, boiling point, and stability, can vary based on the specific conditions and solvents used. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Further studies would be necessary to fully elucidate its potential applications and biological effects.
Formula:C6H7FN2O
InChI:InChI=1S/C6H7FN2O/c7-2-4-9-6(5-10)1-3-8-9/h1,3,5H,2,4H2
InChI key:InChIKey=WMKZXGFPUBBKBW-UHFFFAOYSA-N
SMILES:O=CC1=CC=NN1CCF
- Synonyms:
- 1-(2-Fluoroethyl)-1H-pyrazole-5-carboxaldehyde
- 1H-Pyrazole-5-carboxaldehyde, 1-(2-fluoroethyl)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-(2-Fluoroethyl)-1H-pyrazole-5-carbaldehyde REF: 3D-EHC41753CAS: 1429417-53-7 | Min. 95% | To inquire | Thu 08 May 25 |
![]() | 1-(2-Fluoroethyl)-1H-pyrazole-5-carbaldehyde REF: 10-F769663CAS: 1429417-53-7 | 98% | - - - | Discontinued product |

1-(2-Fluoroethyl)-1H-pyrazole-5-carbaldehyde
Ref: 3D-EHC41753
50mg | 735.00 € | ||
500mg | 2,077.00 € |

1-(2-Fluoroethyl)-1H-pyrazole-5-carbaldehyde
Ref: 10-F769663
1g | Discontinued | Request information |